C12H5BrClF3N2OS — CID 135607822
(Z)-4-bromo-4-chloro-3-hydroxy-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]but-2-enenitrile (PubChem CID 135607822) has the molecular formula C12H5BrClF3N2OS and a molecular weight of 397.60 g/mol. Its IUPAC name is (Z)-4-bromo-4-chloro-3-hydroxy-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]but-2-enenitrile.
| Compound Name | (Z)-4-bromo-4-chloro-3-hydroxy-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 135607822 |
| Molecular Formula | C12H5BrClF3N2OS |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 395.89 |
| IUPAC Name | (Z)-4-bromo-4-chloro-3-hydroxy-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]but-2-enenitrile |
| SMILES | N#C/C(=C(/O)C(Cl)Br)c1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C12H5BrClF3N2OS/c13-10(14)9(20)6(4-18)11-19-7-3-5(12(15,16)17)1-2-8(7)21-11/h1-3,10,20H/b9-6- |
| InChIKey | RXZBEOXNTHIGLD-TWGQIWQCSA-N |
| XLogP | 5.07 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|