C18H8ClF3N2O2S — CID 24633071
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile (PubChem CID 24633071) has the molecular formula C18H8ClF3N2O2S and a molecular weight of 408.79 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 24633071 |
| Molecular Formula | C18H8ClF3N2O2S |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Cl)c2c(c1)OCO2)c1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C18H8ClF3N2O2S/c19-12-4-9(5-14-16(12)26-8-25-14)3-10(7-23)17-24-13-6-11(18(20,21)22)1-2-15(13)27-17/h1-6H,8H2/b10-3+ |
| InChIKey | RSQRMDQMSZSSHS-XCVCLJGOSA-N |
| XLogP | 5.76 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|