C19H12ClN3O3 — CID 9341526
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]prop-2-enenitrile (PubChem CID 9341526) has the molecular formula C19H12ClN3O3 and a molecular weight of 365.78 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 9341526 |
| Molecular Formula | C19H12ClN3O3 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]prop-2-enenitrile |
| SMILES | Cc1ccc(-c2noc(/C(C#N)=C/c3cc(Cl)c4c(c3)OCO4)n2)cc1 |
| InChI | InChI=1S/C19H12ClN3O3/c1-11-2-4-13(5-3-11)18-22-19(26-23-18)14(9-21)6-12-7-15(20)17-16(8-12)24-10-25-17/h2-8H,10H2,1H3/b14-6+ |
| InChIKey | MQOZFAFWCNHEEQ-MKMNVTDBSA-N |
| XLogP | 4.49 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|