C21H15N5O — CID 9335233
(E)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile (PubChem CID 9335233) has the molecular formula C21H15N5O and a molecular weight of 353.39 g/mol. Its IUPAC name is (E)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9335233 |
| Molecular Formula | C21H15N5O |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (E)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3-(1-phenylpyrazol-4-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(-c2noc(/C(C#N)=C/c3cnn(-c4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C21H15N5O/c1-15-7-9-17(10-8-15)20-24-21(27-25-20)18(12-22)11-16-13-23-26(14-16)19-5-3-2-4-6-19/h2-11,13-14H,1H3/b18-11+ |
| InChIKey | FCSGZSGVHHMEPH-WOJGMQOQSA-N |
| XLogP | 4.29 |
| TPSA | 80.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|