C20H16ClN3O3 — CID 135828364
(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]prop-2-enenitrile (PubChem CID 135828364) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 135828364 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(\C#N)c2nc(-c3ccc(C)cc3)no2)cc(Cl)c1O |
| InChI | InChI=1S/C20H16ClN3O3/c1-3-26-17-10-13(9-16(21)18(17)25)8-15(11-22)20-23-19(24-27-20)14-6-4-12(2)5-7-14/h4-10,25H,3H2,1-2H3/b15-8+ |
| InChIKey | UIHDCUCMRNIWKT-OVCLIPMQSA-N |
| XLogP | 4.87 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|