C19H10F3N3S — CID 3843004
3-(1H-indol-3-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile (PubChem CID 3843004) has the molecular formula C19H10F3N3S and a molecular weight of 369.37 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(1H-indol-3-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3843004 |
| Molecular Formula | C19H10F3N3S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1c[nH]c2ccccc12)c1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C19H10F3N3S/c20-19(21,22)13-5-6-17-16(8-13)25-18(26-17)11(9-23)7-12-10-24-15-4-2-1-3-14(12)15/h1-8,10,24H |
| InChIKey | PQJLKKQVSYJRRV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|