C17H8F4N2OS — CID 135607905
(Z)-3-(3-fluorophenyl)-3-hydroxy-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile (PubChem CID 135607905) has the molecular formula C17H8F4N2OS and a molecular weight of 364.32 g/mol. Its IUPAC name is (Z)-3-(3-fluorophenyl)-3-hydroxy-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile.
| Compound Name | (Z)-3-(3-fluorophenyl)-3-hydroxy-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 135607905 |
| Molecular Formula | C17H8F4N2OS |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | (Z)-3-(3-fluorophenyl)-3-hydroxy-2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C(/O)c1cccc(F)c1)c1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C17H8F4N2OS/c18-11-3-1-2-9(6-11)15(24)12(8-22)16-23-13-7-10(17(19,20)21)4-5-14(13)25-16/h1-7,24H/b15-12- |
| InChIKey | UEDHZTNPLSNFJG-QINSGFPZSA-N |
| XLogP | 5.40 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|