C13H7ClF2N2OS — CID 141160692
4-chloro-2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile (PubChem CID 141160692) has the molecular formula C13H7ClF2N2OS and a molecular weight of 312.73 g/mol. Its IUPAC name is 4-chloro-2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile.
| Compound Name | 4-chloro-2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 141160692 |
| Molecular Formula | C13H7ClF2N2OS |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 4-chloro-2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile |
| SMILES | N#CC(=C(O)CCl)c1nc(-c2c(F)cccc2F)cs1 |
| InChI | InChI=1S/C13H7ClF2N2OS/c14-4-11(19)7(5-17)13-18-10(6-20-13)12-8(15)2-1-3-9(12)16/h1-3,6,19H,4H2 |
| InChIKey | CJESKSSQNMMOCS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|