C11H7F2NS — CID 174919803
4-(2,6-difluorophenyl)-2-ethenyl-1,3-thiazole (PubChem CID 174919803) has the molecular formula C11H7F2NS and a molecular weight of 223.25 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-2-ethenyl-1,3-thiazole.
| Compound Name | 4-(2,6-difluorophenyl)-2-ethenyl-1,3-thiazole |
|---|---|
| PubChem CID | 174919803 |
| Molecular Formula | C11H7F2NS |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 4-(2,6-difluorophenyl)-2-ethenyl-1,3-thiazole |
| SMILES | C=Cc1nc(-c2c(F)cccc2F)cs1 |
| InChI | InChI=1S/C11H7F2NS/c1-2-10-14-9(6-15-10)11-7(12)4-3-5-8(11)13/h2-6H,1H2 |
| InChIKey | UADUHTBBCXJFTQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |