C14H14F2N2S — CID 55084480
4-(2,6-difluorophenyl)-2-piperidin-4-yl-1,3-thiazole (PubChem CID 55084480) has the molecular formula C14H14F2N2S and a molecular weight of 280.34 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-2-piperidin-4-yl-1,3-thiazole.
| Compound Name | 4-(2,6-difluorophenyl)-2-piperidin-4-yl-1,3-thiazole |
|---|---|
| PubChem CID | 55084480 |
| Molecular Formula | C14H14F2N2S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 4-(2,6-difluorophenyl)-2-piperidin-4-yl-1,3-thiazole |
| SMILES | Fc1cccc(F)c1-c1csc(C2CCNCC2)n1 |
| InChI | InChI=1S/C14H14F2N2S/c15-10-2-1-3-11(16)13(10)12-8-19-14(18-12)9-4-6-17-7-5-9/h1-3,8-9,17H,4-7H2 |
| InChIKey | OOKANMDVXUVCFC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |