C12H12F2N2S — CID 62651320
2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]propan-1-amine (PubChem CID 62651320) has the molecular formula C12H12F2N2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]propan-1-amine.
| Compound Name | 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 62651320 |
| Molecular Formula | C12H12F2N2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]propan-1-amine |
| SMILES | CC(CN)c1nc(-c2c(F)cccc2F)cs1 |
| InChI | InChI=1S/C12H12F2N2S/c1-7(5-15)12-16-10(6-17-12)11-8(13)3-2-4-9(11)14/h2-4,6-7H,5,15H2,1H3 |
| InChIKey | CQHJMYNTBGVFHD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |