C23H22FN4OS+ — CID 135666939
(Z)-4-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)but-2-enenitrile (PubChem CID 135666939) has the molecular formula C23H22FN4OS+ and a molecular weight of 421.52 g/mol. Its IUPAC name is (Z)-4-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)but-2-enenitrile.
| Compound Name | (Z)-4-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 135666939 |
| Molecular Formula | C23H22FN4OS+ |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (Z)-4-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)but-2-enenitrile |
| SMILES | N#C/C(=C(/O)C[NH+]1CCN(c2ccccc2F)CC1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H21FN4OS/c24-19-8-4-5-9-21(19)28-12-10-27(11-13-28)15-22(29)18(14-25)23-26-20(16-30-23)17-6-2-1-3-7-17/h1-9,16,29H,10-13,15H2/p+1/b22-18- |
| InChIKey | ZGUQIEVCRPVAOV-PYCFMQQDSA-O |
| XLogP | 3.15 |
| TPSA | 64.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|