C19H22BrN3OS — CID 135766948
(Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-(dipropylamino)-3-hydroxybut-2-enenitrile (PubChem CID 135766948) has the molecular formula C19H22BrN3OS and a molecular weight of 420.38 g/mol. Its IUPAC name is (Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-(dipropylamino)-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-(dipropylamino)-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135766948 |
| Molecular Formula | C19H22BrN3OS |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | (Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-(dipropylamino)-3-hydroxybut-2-enenitrile |
| SMILES | CCCN(CCC)C/C(O)=C(\C#N)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C19H22BrN3OS/c1-3-9-23(10-4-2)12-18(24)16(11-21)19-22-17(13-25-19)14-5-7-15(20)8-6-14/h5-8,13,24H,3-4,9-10,12H2,1-2H3/b18-16- |
| InChIKey | PNJIPHZGLMARGH-VLGSPTGOSA-N |
| XLogP | 5.49 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|