C18H21BrN3OS+ — CID 135666944
[(Z)-3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-cyano-2-hydroxyprop-2-enyl]-butyl-methylazanium (PubChem CID 135666944) has the molecular formula C18H21BrN3OS+ and a molecular weight of 407.36 g/mol. Its IUPAC name is [(Z)-3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-cyano-2-hydroxyprop-2-enyl]-butyl-methylazanium.
| Compound Name | [(Z)-3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-cyano-2-hydroxyprop-2-enyl]-butyl-methylazanium |
|---|---|
| PubChem CID | 135666944 |
| Molecular Formula | C18H21BrN3OS+ |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | [(Z)-3-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-cyano-2-hydroxyprop-2-enyl]-butyl-methylazanium |
| SMILES | CCCC[NH+](C)C/C(O)=C(\C#N)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C18H20BrN3OS/c1-3-4-9-22(2)11-17(23)15(10-20)18-21-16(12-24-18)13-5-7-14(19)8-6-13/h5-8,12,23H,3-4,9,11H2,1-2H3/p+1/b17-15- |
| InChIKey | ZKVDEYOAJUSLRN-ICFOKQHNSA-O |
| XLogP | 3.68 |
| TPSA | 61.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|