C17H9BrClN3OS — CID 4206918
2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(6-chloro-3-pyridinyl)-3-hydroxyprop-2-enenitrile (PubChem CID 4206918) has the molecular formula C17H9BrClN3OS and a molecular weight of 418.70 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(6-chloro-3-pyridinyl)-3-hydroxyprop-2-enenitrile.
| Compound Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(6-chloro-3-pyridinyl)-3-hydroxyprop-2-enenitrile |
|---|---|
| PubChem CID | 4206918 |
| Molecular Formula | C17H9BrClN3OS |
| Molecular Weight | 418.70 g/mol |
| Exact Mass | 416.93 |
| IUPAC Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(6-chloro-3-pyridinyl)-3-hydroxyprop-2-enenitrile |
| SMILES | N#CC(=C(O)c1ccc(Cl)nc1)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C17H9BrClN3OS/c18-12-4-1-10(2-5-12)14-9-24-17(22-14)13(7-20)16(23)11-3-6-15(19)21-8-11/h1-6,8-9,23H |
| InChIKey | WVFHJMDZZWGYJI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.70 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|