C18H10Cl2N2OS — CID 142085203
(Z)-2-[4-(2,6-dichlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-3-phenylprop-2-enenitrile (PubChem CID 142085203) has the molecular formula C18H10Cl2N2OS and a molecular weight of 373.26 g/mol. Its IUPAC name is (Z)-2-[4-(2,6-dichlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-3-phenylprop-2-enenitrile.
| Compound Name | (Z)-2-[4-(2,6-dichlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 142085203 |
| Molecular Formula | C18H10Cl2N2OS |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | (Z)-2-[4-(2,6-dichlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-3-phenylprop-2-enenitrile |
| SMILES | N#C/C(=C(/O)c1ccccc1)c1nc(-c2c(Cl)cccc2Cl)cs1 |
| InChI | InChI=1S/C18H10Cl2N2OS/c19-13-7-4-8-14(20)16(13)15-10-24-18(22-15)12(9-21)17(23)11-5-2-1-3-6-11/h1-8,10,23H/b17-12- |
| InChIKey | XYTGRHXBRJLOJB-ATVHPVEESA-N |
| XLogP | 6.07 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|