C23H19ClN2O2S — CID 139782996
[1-(2-chlorophenyl)-2-cyano-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl] 2,2-dimethylpropanoate (PubChem CID 139782996) has the molecular formula C23H19ClN2O2S and a molecular weight of 422.94 g/mol. Its IUPAC name is [1-(2-chlorophenyl)-2-cyano-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl] 2,2-dimethylpropanoate.
| Compound Name | [1-(2-chlorophenyl)-2-cyano-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139782996 |
| Molecular Formula | C23H19ClN2O2S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | [1-(2-chlorophenyl)-2-cyano-2-(4-phenyl-1,3-thiazol-2-yl)ethenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(=C(C#N)c1nc(-c2ccccc2)cs1)c1ccccc1Cl |
| InChI | InChI=1S/C23H19ClN2O2S/c1-23(2,3)22(27)28-20(16-11-7-8-12-18(16)24)17(13-25)21-26-19(14-29-21)15-9-5-4-6-10-15/h4-12,14H,1-3H3 |
| InChIKey | OIMXFWUPCMFQOY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|