C21H23N3O3S — CID 135577581
ethyl (3S)-1-[(Z)-3-cyano-2-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)prop-2-enyl]piperidine-3-carboxylate (PubChem CID 135577581) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is ethyl (3S)-1-[(Z)-3-cyano-2-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)prop-2-enyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(Z)-3-cyano-2-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)prop-2-enyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 135577581 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | ethyl (3S)-1-[(Z)-3-cyano-2-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)prop-2-enyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C/C(O)=C(\C#N)c2nc(-c3ccccc3)cs2)C1 |
| InChI | InChI=1S/C21H23N3O3S/c1-2-27-21(26)16-9-6-10-24(12-16)13-19(25)17(11-22)20-23-18(14-28-20)15-7-4-3-5-8-15/h3-5,7-8,14,16,25H,2,6,9-10,12-13H2,1H3/b19-17-/t16-/m0/s1 |
| InChIKey | XSXCSYAHZMXMRV-NCJSADBTSA-N |
| XLogP | 3.88 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|