C24H23ClN4OS — CID 135474172
(Z)-4-(4-benzylpiperazin-1-yl)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile (PubChem CID 135474172) has the molecular formula C24H23ClN4OS and a molecular weight of 451.00 g/mol. Its IUPAC name is (Z)-4-(4-benzylpiperazin-1-yl)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-4-(4-benzylpiperazin-1-yl)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135474172 |
| Molecular Formula | C24H23ClN4OS |
| Molecular Weight | 451.00 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (Z)-4-(4-benzylpiperazin-1-yl)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)CN1CCN(Cc2ccccc2)CC1)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C24H23ClN4OS/c25-20-8-6-19(7-9-20)22-17-31-24(27-22)21(14-26)23(30)16-29-12-10-28(11-13-29)15-18-4-2-1-3-5-18/h1-9,17,30H,10-13,15-16H2/b23-21- |
| InChIKey | FJAZEPQAXFOZKD-LNVKXUELSA-N |
| XLogP | 5.07 |
| TPSA | 63.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.00 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|