C22H12Cl2N2O2S — CID 135847071
(Z)-3-[5-(2,5-dichlorophenyl)furan-2-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 135847071) has the molecular formula C22H12Cl2N2O2S and a molecular weight of 439.32 g/mol. Its IUPAC name is (Z)-3-[5-(2,5-dichlorophenyl)furan-2-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[5-(2,5-dichlorophenyl)furan-2-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135847071 |
| Molecular Formula | C22H12Cl2N2O2S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | (Z)-3-[5-(2,5-dichlorophenyl)furan-2-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C(/O)c1ccc(-c2cc(Cl)ccc2Cl)o1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H12Cl2N2O2S/c23-14-6-7-17(24)15(10-14)19-8-9-20(28-19)21(27)16(11-25)22-26-18(12-29-22)13-4-2-1-3-5-13/h1-10,12,27H/b21-16- |
| InChIKey | PQLRWRXRWMPZGZ-PGMHBOJBSA-N |
| XLogP | 7.33 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|