C26H15N3O4S — CID 135847069
(Z)-3-hydroxy-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 135847069) has the molecular formula C26H15N3O4S and a molecular weight of 465.49 g/mol. Its IUPAC name is (Z)-3-hydroxy-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | (Z)-3-hydroxy-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 135847069 |
| Molecular Formula | C26H15N3O4S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | (Z)-3-hydroxy-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C(/O)c1ccc(-c2cccc([N+](=O)[O-])c2)o1)c1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C26H15N3O4S/c27-14-21(25(30)24-11-10-23(33-24)19-6-3-7-20(13-19)29(31)32)26-28-22(15-34-26)18-9-8-16-4-1-2-5-17(16)12-18/h1-13,15,30H/b25-21- |
| InChIKey | NXPCGWOEONHJSD-DAFNUICNSA-N |
| XLogP | 7.08 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|