C24H15F3N2O2S — CID 5262536
3-hydroxy-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enenitrile (PubChem CID 5262536) has the molecular formula C24H15F3N2O2S and a molecular weight of 452.46 g/mol. Its IUPAC name is 3-hydroxy-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enenitrile.
| Compound Name | 3-hydroxy-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 5262536 |
| Molecular Formula | C24H15F3N2O2S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 3-hydroxy-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enenitrile |
| SMILES | Cc1ccc(-c2csc(C(C#N)=C(O)c3ccc(-c4cccc(C(F)(F)F)c4)o3)n2)cc1 |
| InChI | InChI=1S/C24H15F3N2O2S/c1-14-5-7-15(8-6-14)19-13-32-23(29-19)18(12-28)22(30)21-10-9-20(31-21)16-3-2-4-17(11-16)24(25,26)27/h2-11,13,30H,1H3 |
| InChIKey | BEGVGSFQSHSMME-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|