C26H14Cl2N2O2S — CID 5262366
3-[5-(2,5-dichlorophenyl)furan-2-yl]-3-hydroxy-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 5262366) has the molecular formula C26H14Cl2N2O2S and a molecular weight of 489.38 g/mol. Its IUPAC name is 3-[5-(2,5-dichlorophenyl)furan-2-yl]-3-hydroxy-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-[5-(2,5-dichlorophenyl)furan-2-yl]-3-hydroxy-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5262366 |
| Molecular Formula | C26H14Cl2N2O2S |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | 3-[5-(2,5-dichlorophenyl)furan-2-yl]-3-hydroxy-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#CC(=C(O)c1ccc(-c2cc(Cl)ccc2Cl)o1)c1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C26H14Cl2N2O2S/c27-18-7-8-21(28)19(12-18)23-9-10-24(32-23)25(31)20(13-29)26-30-22(14-33-26)17-6-5-15-3-1-2-4-16(15)11-17/h1-12,14,31H |
| InChIKey | IRMKSHBXRKRIRP-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|