C19H12Cl2N2OS — CID 135691138
(Z)-4-chloro-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-phenylbut-2-enenitrile (PubChem CID 135691138) has the molecular formula C19H12Cl2N2OS and a molecular weight of 387.29 g/mol. Its IUPAC name is (Z)-4-chloro-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-phenylbut-2-enenitrile.
| Compound Name | (Z)-4-chloro-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-phenylbut-2-enenitrile |
|---|---|
| PubChem CID | 135691138 |
| Molecular Formula | C19H12Cl2N2OS |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | (Z)-4-chloro-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-phenylbut-2-enenitrile |
| SMILES | N#C/C(=C(/O)C(Cl)c1ccccc1)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C19H12Cl2N2OS/c20-14-8-6-12(7-9-14)16-11-25-19(23-16)15(10-22)18(24)17(21)13-4-2-1-3-5-13/h1-9,11,17,24H/b18-15- |
| InChIKey | LLMWZYDTLKXQQC-SDXDJHTJSA-N |
| XLogP | 6.24 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|