C31H19Cl2N5O2S2 — CID 136777638
(Z)-2,5-bis[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-(4-oxo-3H-quinazolin-2-yl)pent-2-enenitrile (PubChem CID 136777638) has the molecular formula C31H19Cl2N5O2S2 and a molecular weight of 628.57 g/mol. Its IUPAC name is (Z)-2,5-bis[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-(4-oxo-3H-quinazolin-2-yl)pent-2-enenitrile.
| Compound Name | (Z)-2,5-bis[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-(4-oxo-3H-quinazolin-2-yl)pent-2-enenitrile |
|---|---|
| PubChem CID | 136777638 |
| Molecular Formula | C31H19Cl2N5O2S2 |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 627.04 |
| IUPAC Name | (Z)-2,5-bis[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-(4-oxo-3H-quinazolin-2-yl)pent-2-enenitrile |
| SMILES | N#C/C(=C(/O)CC(c1nc2ccccc2c(=O)[nH]1)c1nc(-c2ccc(Cl)cc2)cs1)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C31H19Cl2N5O2S2/c32-19-9-5-17(6-10-19)25-15-41-30(36-25)22(28-35-24-4-2-1-3-21(24)29(40)38-28)13-27(39)23(14-34)31-37-26(16-42-31)18-7-11-20(33)12-8-18/h1-12,15-16,22,39H,13H2,(H,35,38,40)/b27-23- |
| InChIKey | KVCYDBHAWYUIAV-VYIQYICTSA-N |
| XLogP | 8.49 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|