C20H24N3OS+ — CID 135725998
(Z)-4-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)but-2-enenitrile (PubChem CID 135725998) has the molecular formula C20H24N3OS+ and a molecular weight of 354.50 g/mol. Its IUPAC name is (Z)-4-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)but-2-enenitrile.
| Compound Name | (Z)-4-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 135725998 |
| Molecular Formula | C20H24N3OS+ |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (Z)-4-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-3-hydroxy-2-(4-phenyl-1,3-thiazol-2-yl)but-2-enenitrile |
| SMILES | C[C@@H]1C[C@@H](C)C[NH+](C/C(O)=C(\C#N)c2nc(-c3ccccc3)cs2)C1 |
| InChI | InChI=1S/C20H23N3OS/c1-14-8-15(2)11-23(10-14)12-19(24)17(9-21)20-22-18(13-25-20)16-6-4-3-5-7-16/h3-7,13-15,24H,8,10-12H2,1-2H3/p+1/b19-17-/t14-,15-/m1/s1 |
| InChIKey | XTILHWXBEFLQIZ-NHWLHPCLSA-O |
| XLogP | 3.16 |
| TPSA | 61.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|