C17H17BrN3O2S+ — CID 135796348
(Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-morpholin-4-ium-4-ylbut-2-enenitrile (PubChem CID 135796348) has the molecular formula C17H17BrN3O2S+ and a molecular weight of 407.31 g/mol. Its IUPAC name is (Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-morpholin-4-ium-4-ylbut-2-enenitrile.
| Compound Name | (Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-morpholin-4-ium-4-ylbut-2-enenitrile |
|---|---|
| PubChem CID | 135796348 |
| Molecular Formula | C17H17BrN3O2S+ |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | (Z)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-hydroxy-4-morpholin-4-ium-4-ylbut-2-enenitrile |
| SMILES | N#C/C(=C(/O)C[NH+]1CCOCC1)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C17H16BrN3O2S/c18-13-3-1-12(2-4-13)15-11-24-17(20-15)14(9-19)16(22)10-21-5-7-23-8-6-21/h1-4,11,22H,5-8,10H2/p+1/b16-14- |
| InChIKey | QGXIBXSGFGLTLL-PEZBUJJGSA-O |
| XLogP | 2.28 |
| TPSA | 70.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|