C27H28N4O5S — CID 2353773
4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile (PubChem CID 2353773) has the molecular formula C27H28N4O5S and a molecular weight of 520.61 g/mol. Its IUPAC name is 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile.
| Compound Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 2353773 |
| Molecular Formula | C27H28N4O5S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile |
| SMILES | COc1ccc(-c2csc(C(C#N)=C(O)CN3CCN(Cc4ccc5c(c4)OCO5)CC3)n2)cc1OC |
| InChI | InChI=1S/C27H28N4O5S/c1-33-23-6-4-19(12-25(23)34-2)21-16-37-27(29-21)20(13-28)22(32)15-31-9-7-30(8-10-31)14-18-3-5-24-26(11-18)36-17-35-24/h3-6,11-12,16,32H,7-10,14-15,17H2,1-2H3 |
| InChIKey | WVUKKPYZIZMCNR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|