C24H23N3O2S — CID 4153985
2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-pyrrolidin-1-ylphenyl)prop-2-enenitrile (PubChem CID 4153985) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-pyrrolidin-1-ylphenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-pyrrolidin-1-ylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4153985 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-(2-pyrrolidin-1-ylphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(-c2csc(C(C#N)=Cc3ccccc3N3CCCC3)n2)cc1OC |
| InChI | InChI=1S/C24H23N3O2S/c1-28-22-10-9-17(14-23(22)29-2)20-16-30-24(26-20)19(15-25)13-18-7-3-4-8-21(18)27-11-5-6-12-27/h3-4,7-10,13-14,16H,5-6,11-12H2,1-2H3 |
| InChIKey | WIXSOBPBNCZVQU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|