C22H20ClN3OS — CID 70551895
[3-(2-chlorophenyl)-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)prop-1-enylidene]azanide;pyrrolidin-1-ium (PubChem CID 70551895) has the molecular formula C22H20ClN3OS and a molecular weight of 409.94 g/mol. Its IUPAC name is [3-(2-chlorophenyl)-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)prop-1-enylidene]azanide;pyrrolidin-1-ium.
| Compound Name | [3-(2-chlorophenyl)-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)prop-1-enylidene]azanide;pyrrolidin-1-ium |
|---|---|
| PubChem CID | 70551895 |
| Molecular Formula | C22H20ClN3OS |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | [3-(2-chlorophenyl)-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)prop-1-enylidene]azanide;pyrrolidin-1-ium |
| SMILES | C1CC[NH2+]C1.[N-]=C=C(C(=O)c1ccccc1Cl)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H10ClN2OS.C4H9N/c19-15-9-5-4-8-13(15)17(22)14(10-20)18-21-16(11-23-18)12-6-2-1-3-7-12;1-2-4-5-3-1/h1-9,11H;5H,1-4H2/q-1;/p+1 |
| InChIKey | RKWSIOGSOBAPEA-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|