C22H16ClN3OS — CID 2295552
N-(2-chlorophenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide (PubChem CID 2295552) has the molecular formula C22H16ClN3OS and a molecular weight of 405.91 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide.
| Compound Name | N-(2-chlorophenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 2295552 |
| Molecular Formula | C22H16ClN3OS |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-(2-chlorophenyl)-2-[(4-phenyl-1,3-thiazol-2-yl)amino]benzamide |
| SMILES | O=C(Nc1ccccc1Cl)c1ccccc1Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H16ClN3OS/c23-17-11-5-7-13-19(17)24-21(27)16-10-4-6-12-18(16)25-22-26-20(14-28-22)15-8-2-1-3-9-15/h1-14H,(H,24,27)(H,25,26) |
| InChIKey | PNYWSBZTRYETCQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |