C23H16ClN3O — CID 4245690
N-(2-chlorophenyl)-4,6-diphenylpyrimidine-2-carboxamide (PubChem CID 4245690) has the molecular formula C23H16ClN3O and a molecular weight of 385.85 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4,6-diphenylpyrimidine-2-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4,6-diphenylpyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 4245690 |
| Molecular Formula | C23H16ClN3O |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-(2-chlorophenyl)-4,6-diphenylpyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H16ClN3O/c24-18-13-7-8-14-19(18)27-23(28)22-25-20(16-9-3-1-4-10-16)15-21(26-22)17-11-5-2-6-12-17/h1-15H,(H,27,28) |
| InChIKey | FRQWBUKBQIUKQT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |