C17H13N3O2 — CID 164614577
N-hydroxy-4,6-diphenylpyrimidine-2-carboxamide (PubChem CID 164614577) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-hydroxy-4,6-diphenylpyrimidine-2-carboxamide.
| Compound Name | N-hydroxy-4,6-diphenylpyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 164614577 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-hydroxy-4,6-diphenylpyrimidine-2-carboxamide |
| SMILES | O=C(NO)c1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H13N3O2/c21-17(20-22)16-18-14(12-7-3-1-4-8-12)11-15(19-16)13-9-5-2-6-10-13/h1-11,22H,(H,20,21) |
| InChIKey | IJOTVYKDHDOPEF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|