C23H25N3O2S — CID 162394736
7-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-hydroxyheptanamide (PubChem CID 162394736) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 7-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-hydroxyheptanamide.
| Compound Name | 7-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 162394736 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 7-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCSc1nc(-c2ccccc2)cc(-c2ccccc2)n1)NO |
| InChI | InChI=1S/C23H25N3O2S/c27-22(26-28)15-9-1-2-10-16-29-23-24-20(18-11-5-3-6-12-18)17-21(25-23)19-13-7-4-8-14-19/h3-8,11-14,17,28H,1-2,9-10,15-16H2,(H,26,27) |
| InChIKey | YWQVUAJXILHKOJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|