C23H24ClN3O3S — CID 162395756
6-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]sulfanyl-N-hydroxyhexanamide (PubChem CID 162395756) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is 6-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]sulfanyl-N-hydroxyhexanamide.
| Compound Name | 6-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]sulfanyl-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 162395756 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 6-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]sulfanyl-N-hydroxyhexanamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(Cl)cc3)nc(SCCCCCC(=O)NO)n2)cc1 |
| InChI | InChI=1S/C23H24ClN3O3S/c1-30-19-12-8-17(9-13-19)21-15-20(16-6-10-18(24)11-7-16)25-23(26-21)31-14-4-2-3-5-22(28)27-29/h6-13,15,29H,2-5,14H2,1H3,(H,27,28) |
| InChIKey | PBVCOTJREIFDBI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|