C26H23ClN4O3 — CID 50751113
N-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]-2-(4-methoxyanilino)acetamide (PubChem CID 50751113) has the molecular formula C26H23ClN4O3 and a molecular weight of 474.95 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]-2-(4-methoxyanilino)acetamide.
| Compound Name | N-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]-2-(4-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 50751113 |
| Molecular Formula | C26H23ClN4O3 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-[4-(4-chlorophenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]-2-(4-methoxyanilino)acetamide |
| SMILES | COc1ccc(NCC(=O)Nc2nc(-c3ccc(Cl)cc3)cc(-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C26H23ClN4O3/c1-33-21-11-5-18(6-12-21)24-15-23(17-3-7-19(27)8-4-17)29-26(30-24)31-25(32)16-28-20-9-13-22(34-2)14-10-20/h3-15,28H,16H2,1-2H3,(H,29,30,31,32) |
| InChIKey | NXHYUIREURXFEX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|