C26H21F3N4O2 — CID 46269845
N-[4-(4-methoxyphenyl)-6-phenylpyrimidin-2-yl]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 46269845) has the molecular formula C26H21F3N4O2 and a molecular weight of 478.47 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-6-phenylpyrimidin-2-yl]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[4-(4-methoxyphenyl)-6-phenylpyrimidin-2-yl]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 46269845 |
| Molecular Formula | C26H21F3N4O2 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-6-phenylpyrimidin-2-yl]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(NC(=O)CNc3cccc(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C26H21F3N4O2/c1-35-21-12-10-18(11-13-21)23-15-22(17-6-3-2-4-7-17)31-25(32-23)33-24(34)16-30-20-9-5-8-19(14-20)26(27,28)29/h2-15,30H,16H2,1H3,(H,31,32,33,34) |
| InChIKey | MRZCYVBZNGIHPU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |