C23H17F3N2O — CID 121284743
2-(4-methoxyphenyl)-N-[3-(trifluoromethyl)phenyl]quinolin-4-amine (PubChem CID 121284743) has the molecular formula C23H17F3N2O and a molecular weight of 394.40 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[3-(trifluoromethyl)phenyl]quinolin-4-amine.
| Compound Name | 2-(4-methoxyphenyl)-N-[3-(trifluoromethyl)phenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 121284743 |
| Molecular Formula | C23H17F3N2O |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[3-(trifluoromethyl)phenyl]quinolin-4-amine |
| SMILES | COc1ccc(-c2cc(Nc3cccc(C(F)(F)F)c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H17F3N2O/c1-29-18-11-9-15(10-12-18)21-14-22(19-7-2-3-8-20(19)28-21)27-17-6-4-5-16(13-17)23(24,25)26/h2-14H,1H3,(H,27,28) |
| InChIKey | OGDIDHAPGDKVEK-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |