About 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide
2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide (PubChem CID 3640790) has the molecular formula C22H23N3OS
and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide |
| PubChem CID | 3640790 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H23N3OS/c1-3-25(4-2)21(26)16-27-22-23-19(17-11-7-5-8-12-17)15-20(24-22)18-13-9-6-10-14-18/h5-15H,3-4,16H2,1-2H3 |
| InChIKey | GCHMMAXKOYCBAZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide?
The IUPAC name of 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide (CID 3640790) is 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide.
What is the SMILES notation for 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide?
The canonical SMILES for 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide is CCN(CC)C(=O)CSc1nc(-c2ccccc2)cc(-c2ccccc2)n1.
What is the InChIKey of 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide?
The InChIKey is GCHMMAXKOYCBAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3OS/c1-3-25(4-2)21(26)16-27-22-23-19(17-11-7-5-8-12-17)15-20(24-22)18-13-9-6-10-14-18/h5-15H,3-4,16H2,1-2H3.
What are the key properties of 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide?
2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide has a molecular weight of 377.51 g/mol, XLogP of 4.77, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N,N-diethylacetamide is sourced from PubChem (CID 3640790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).