C20H22N4OS — CID 17288729
2-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethylacetamide (PubChem CID 17288729) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethylacetamide.
| Compound Name | 2-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 17288729 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H22N4OS/c1-3-23(4-2)18(25)15-26-20-21-19(16-11-7-5-8-12-16)24(22-20)17-13-9-6-10-14-17/h5-14H,3-4,15H2,1-2H3 |
| InChIKey | URFJUOQAWUYWOL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |