C19H19N3O2S — CID 17288856
propan-2-yl 2-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 17288856) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is propan-2-yl 2-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | propan-2-yl 2-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 17288856 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | propan-2-yl 2-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | CC(C)OC(=O)CSc1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H19N3O2S/c1-14(2)24-17(23)13-25-19-20-18(15-9-5-3-6-10-15)22(21-19)16-11-7-4-8-12-16/h3-12,14H,13H2,1-2H3 |
| InChIKey | PFCUVLZHUGTOMT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |