C20H16N4S — CID 17288751
4-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine (PubChem CID 17288751) has the molecular formula C20H16N4S and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine.
| Compound Name | 4-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 17288751 |
| Molecular Formula | C20H16N4S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 4-[(1,5-diphenyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine |
| SMILES | c1ccc(-c2nc(SCc3ccncc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16N4S/c1-3-7-17(8-4-1)19-22-20(25-15-16-11-13-21-14-12-16)23-24(19)18-9-5-2-6-10-18/h1-14H,15H2 |
| InChIKey | ZVOBNGCWVFXSRM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |