C21H20N6OS3 — CID 139067885
2,4,6-tris(pyridin-4-ylmethylsulfanyl)-1,3,5-triazine;hydrate (PubChem CID 139067885) has the molecular formula C21H20N6OS3 and a molecular weight of 468.63 g/mol. Its IUPAC name is 2,4,6-tris(pyridin-4-ylmethylsulfanyl)-1,3,5-triazine;hydrate.
| Compound Name | 2,4,6-tris(pyridin-4-ylmethylsulfanyl)-1,3,5-triazine;hydrate |
|---|---|
| PubChem CID | 139067885 |
| Molecular Formula | C21H20N6OS3 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2,4,6-tris(pyridin-4-ylmethylsulfanyl)-1,3,5-triazine;hydrate |
| SMILES | O.c1cc(CSc2nc(SCc3ccncc3)nc(SCc3ccncc3)n2)ccn1 |
| InChI | InChI=1S/C21H18N6S3.H2O/c1-7-22-8-2-16(1)13-28-19-25-20(29-14-17-3-9-23-10-4-17)27-21(26-19)30-15-18-5-11-24-12-6-18;/h1-12H,13-15H2;1H2 |
| InChIKey | WMEBZTKANRIGKP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 108.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |