C21H21N3OS — CID 8729649
N-benzyl-N-methyl-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 8729649) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-benzyl-N-methyl-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8729649 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-benzyl-N-methyl-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(-c2ccccc2)nc(SCC(=O)N(C)Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H21N3OS/c1-16-13-19(18-11-7-4-8-12-18)23-21(22-16)26-15-20(25)24(2)14-17-9-5-3-6-10-17/h3-13H,14-15H2,1-2H3 |
| InChIKey | NZXNQJORRITNFC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |