C19H16F3N3OS2 — CID 17095482
N-benzyl-N-methyl-2-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 17095482) has the molecular formula C19H16F3N3OS2 and a molecular weight of 423.49 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzyl-N-methyl-2-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 17095482 |
| Molecular Formula | C19H16F3N3OS2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | N-benzyl-N-methyl-2-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | CN(Cc1ccccc1)C(=O)CSc1nc(-c2cccs2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H16F3N3OS2/c1-25(11-13-6-3-2-4-7-13)17(26)12-28-18-23-14(15-8-5-9-27-15)10-16(24-18)19(20,21)22/h2-10H,11-12H2,1H3 |
| InChIKey | YTVJHJXCRQLYFC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |