C14H13F3N2O2S2 — CID 134201947
methyl 4-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylbutanoate (PubChem CID 134201947) has the molecular formula C14H13F3N2O2S2 and a molecular weight of 362.40 g/mol. Its IUPAC name is methyl 4-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylbutanoate.
| Compound Name | methyl 4-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 134201947 |
| Molecular Formula | C14H13F3N2O2S2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | methyl 4-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylbutanoate |
| SMILES | COC(=O)CCCSc1nc(-c2cccs2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H13F3N2O2S2/c1-21-12(20)5-3-7-23-13-18-9(10-4-2-6-22-10)8-11(19-13)14(15,16)17/h2,4,6,8H,3,5,7H2,1H3 |
| InChIKey | MRPBLCIHYOMQGZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|