C18H16F3N3O2S2 — CID 2237232
4-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 2237232) has the molecular formula C18H16F3N3O2S2 and a molecular weight of 427.47 g/mol. Its IUPAC name is 4-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | 4-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 2237232 |
| Molecular Formula | C18H16F3N3O2S2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 4-[4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | O=C(CCCSc1nc(-c2ccco2)cc(C(F)(F)F)n1)NCc1cccs1 |
| InChI | InChI=1S/C18H16F3N3O2S2/c19-18(20,21)15-10-13(14-5-1-7-26-14)23-17(24-15)28-9-3-6-16(25)22-11-12-4-2-8-27-12/h1-2,4-5,7-8,10H,3,6,9,11H2,(H,22,25) |
| InChIKey | PAFWWDCVAZBLNI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|