C15H16F3N3OS2 — CID 1152391
N-tert-butyl-2-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 1152391) has the molecular formula C15H16F3N3OS2 and a molecular weight of 375.44 g/mol. Its IUPAC name is N-tert-butyl-2-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-tert-butyl-2-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 1152391 |
| Molecular Formula | C15H16F3N3OS2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-tert-butyl-2-[4-thiophen-2-yl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | CC(C)(C)NC(=O)CSc1nc(-c2cccs2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H16F3N3OS2/c1-14(2,3)21-12(22)8-24-13-19-9(10-5-4-6-23-10)7-11(20-13)15(16,17)18/h4-7H,8H2,1-3H3,(H,21,22) |
| InChIKey | XOVFMRKANLDJSW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |