C23H17N5O — CID 1381235
4,6-diphenyl-N-(pyridin-3-ylmethylideneamino)pyrimidine-2-carboxamide (PubChem CID 1381235) has the molecular formula C23H17N5O and a molecular weight of 379.42 g/mol. Its IUPAC name is 4,6-diphenyl-N-(pyridin-3-ylmethylideneamino)pyrimidine-2-carboxamide.
| Compound Name | 4,6-diphenyl-N-(pyridin-3-ylmethylideneamino)pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1381235 |
| Molecular Formula | C23H17N5O |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4,6-diphenyl-N-(pyridin-3-ylmethylideneamino)pyrimidine-2-carboxamide |
| SMILES | O=C(NN=Cc1cccnc1)c1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H17N5O/c29-23(28-25-16-17-8-7-13-24-15-17)22-26-20(18-9-3-1-4-10-18)14-21(27-22)19-11-5-2-6-12-19/h1-16H,(H,28,29) |
| InChIKey | WQQWBFCRBOOHJE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|