About iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate)
iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate) (PubChem CID 175287242) has the molecular formula C24H18IrN4O4-2
and a molecular weight of 618.65 g/mol. Its IUPAC name is iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate).
Molecular Properties
| Compound Name | iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate) |
| PubChem CID | 175287242 |
| Molecular Formula | C24H18IrN4O4-2 |
| Molecular Weight | 618.65 g/mol |
| Exact Mass | 619.10 |
| IUPAC Name | iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate) |
| SMILES | Cc1cc(-c2ccccc2)nc(C(=O)[O-])n1.Cc1cc(-c2ccccc2)nc(C(=O)[O-])n1.[Ir] |
| InChI | InChI=1S/2C12H10N2O2.Ir/c2*1-8-7-10(9-5-3-2-4-6-9)14-11(13-8)12(15)16;/h2*2-7H,1H3,(H,15,16);/p-2 |
| InChIKey | UIGIBUDDWVOXMQ-UHFFFAOYSA-L |
| XLogP | 1.63 |
| TPSA | 131.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 618.65 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate)?
The IUPAC name of iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate) (CID 175287242) is iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate).
What is the SMILES notation for iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate)?
The canonical SMILES for iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate) is Cc1cc(-c2ccccc2)nc(C(=O)[O-])n1.Cc1cc(-c2ccccc2)nc(C(=O)[O-])n1.[Ir].
What is the InChIKey of iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate)?
The InChIKey is UIGIBUDDWVOXMQ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H10N2O2.Ir/c2*1-8-7-10(9-5-3-2-4-6-9)14-11(13-8)12(15)16;/h2*2-7H,1H3,(H,15,16);/p-2.
What are the key properties of iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate)?
iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate) has a molecular weight of 618.65 g/mol, XLogP of 1.63, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;bis(4-methyl-6-phenylpyrimidine-2-carboxylate) is sourced from PubChem (CID 175287242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).